JFIFXX    $.' ",#(7),01444'9=82<.342  2!!22222222222222222222222222222222222222222222222222"4 ,PG"Z_4˷kjزZ,F+_z,© zh6٨icfu#ډb_N?wQ5-~I8TK<5oIv-k_U_~bMdӜUHh?]EwQk{_}qFW7HTՑYF?_'ϔ_Ջt=||I 6έ"D/[k9Y8ds|\Ҿp6Ҵ].6znopM[mei$[soᘨ˸ nɜG-ĨUycP3.DBli;hjx7Z^NhN3u{:jx힞#M&jL P@_ P&o89@Sz6t7#Oߋ s}YfTlmrZ)'Nk۞pw\Tȯ?8`Oi{wﭹW[r Q4F׊3m&L=h3z~#\l :F,j@ ʱwQT8"kJO6֚l}R>ډK]y&p}b;N1mr$|7>e@BTM*-iHgD) Em|ؘbҗaҾt4oG*oCNrPQ@z,|?W[0:n,jWiEW$~/hp\?{(0+Y8rΟ+>S-SVN;}s?. w9˟<Mq4Wv'{)01mBVW[8/< %wT^5b)iM pgN&ݝVO~qu9 !J27$O-! :%H ـyΠM=t{!S oK8txA& j0 vF Y|y ~6@c1vOpIg4lODL Rcj_uX63?nkWyf;^*B @~a`Eu+6L.ü>}y}_O6͐:YrGXkGl^w~㒶syIu! W XN7BVO!X2wvGRfT#t/?%8^WaTGcLMI(J1~8?aT ]ASE(*E} 2#I/׍qz^t̔bYz4xt){ OH+(EA&NXTo"XC')}Jzp ~5}^+6wcQ|LpdH}(.|kc4^"Z?ȕ a<L!039C EuCFEwç ;n?*oB8bʝ'#RqfM}7]s2tcS{\icTx;\7KPʇ Z O-~c>"?PEO8@8GQgaՎ󁶠䧘_%#r>1zaebqcPѵn#L =׀t L7`VA{C:ge@w1 Xp3c3ġpM"'-@n4fGB3DJ8[JoߐgK)ƛ$ 83+ 6ʻ SkI*KZlT _`?KQKdB`s}>`*>,*@JdoF*弝O}ks]yߘc1GV<=776qPTtXԀ!9*44Tހ3XΛex46YD  BdemDa\_l,G/֌7Y](xTt^%GE4}bTڹ;Y)BQu>J/J ⮶.XԄjݳ+Ed r5_D1 o Bx΢#<W8R6@gM. drD>(otU@x=~v2 ӣdoBd3eO6㣷ݜ66YQz`S{\P~z m5{J/L1xO\ZFu>ck#&:`$ai>2ΔloF[hlEܺΠk:)` $[69kOw\|8}ބ:񶐕IA1/=2[,!.}gN#ub ~݊}34qdELc$"[qU硬g^%B zrpJru%v\h1Yne`ǥ:gpQM~^Xi `S:V29.PV?Bk AEvw%_9CQwKekPؠ\;Io d{ ߞoc1eP\ `E=@KIRYK2NPlLɀ)&eB+ь( JTx_?EZ }@ 6U뙢طzdWIn` D噥[uV"G&Ú2g}&m?ċ"Om# {ON"SXNeysQ@FnVgdX~nj]J58up~.`r\O,ư0oS _Ml4kv\JSdxSW<AeIX$Iw:Sy›R9Q[,5;@]%u@ *rolbI  +%m:͇ZVủθau,RW33 dJeTYE.Mϧ-oj3+yy^cVO9NV\nd1 !͕_)av;թMlWR1)ElP;yوÏu 3k5Pr6<⒲l!˞*u־n!l:UNW %Chx8vL'X@*)̮ˍ D-M+JUkvK+x8cY?Ԡ~3mo|u@[XeYC\Kpx8oCC&N~3-H MXsu<`~"WL$8ξ3a)|:@m\^`@ҷ)5p+6p%i)P Mngc#0AruzRL+xSS?ʮ}()#tmˇ!0}}y$6Lt;$ʳ{^6{v6ķܰgVcnn ~zx«,2u?cE+ȘH؎%Za)X>uWTzNyosFQƤ$*&LLXL)1" LeOɟ9=:tZcŽY?ӭVwv~,Yrۗ|yGaFC.+ v1fήJ]STBn5sW}y$~z'c 8  ,! pVNSNNqy8z˱A4*'2n<s^ǧ˭PJޮɏUGLJ*#i}K%,)[z21z ?Nin1?TIR#m-1lA`fT5+ܐcq՝ʐ,3f2Uեmab#ŠdQy>\)SLYw#.ʑf ,"+w~N'cO3FN<)j&,- љ֊_zSTǦw>?nU仆Ve0$CdrP m׈eXmVu L.bֹ [Դaզ*\y8Է:Ez\0KqC b̘cөQ=0YsNS.3.Oo:#v7[#߫ 5܎LEr49nCOWlG^0k%;YߝZǓ:S#|}y,/kLd TA(AI$+I3;Y*Z}|ӧOdv..#:nf>>ȶITX 8y"dR|)0=n46ⲑ+ra ~]R̲c?6(q;5% |uj~z8R=XIV=|{vGj\gcqz؋%Mߍ1y#@f^^>N#x#۹6Y~?dfPO{P4Vu1E1J *|%JN`eWuzk M6q t[ gGvWIGu_ft5j"Y:Tɐ*; e54q$C2d} _SL#mYpO.C;cHi#֩%+) ӍƲVSYźg |tj38r|V1#;.SQA[S#`n+$$I P\[@s(EDzP])8G#0B[ىXIIq<9~[Z멜Z⊔IWU&A>P~#dp]9 "cP Md?٥Ifتuk/F9c*9Ǎ:ØFzn*@|Iށ9N3{'['ͬҲ4#}!V Fu,,mTIkv C7vB6kT91*l '~ƞFlU'M ][ΩũJ_{iIn$L jOdxkza۪#EClx˘oVɞljr)/,߬hL#^Lф,íMƁe̩NBLiLq}(q6IçJ$WE$:=#(KBzђ xlx?>Պ+>W,Ly!_DŌlQ![ SJ1ƐY}b,+Loxɓ)=yoh@꥟/Iѭ=Py9 ۍYӘe+pJnϱ?V\SO%(t =?MR[Șd/ nlB7j !;ӥ/[-A>dNsLj ,ɪv=1c.SQO3UƀܽE̻9GϷD7(}Ävӌ\y_0[w <΍>a_[0+LF.޺f>oNTq;y\bՃyjH<|q-eɏ_?_9+PHp$[uxK wMwNی'$Y2=qKBP~Yul:[<F12O5=d]Ysw:ϮEj,_QXz`H1,#II dwrP˂@ZJVy$\y{}^~[:NߌUOdؾe${p>G3cĖlʌ ת[`ϱ-WdgIig2 }s ؤ(%#sS@~3XnRG~\jc3vӍLM[JBTs3}jNʖW;7ç?=XF=-=qߚ#='c7ڑWI(O+=:uxqe2zi+kuGR0&eniT^J~\jyp'dtGsO39* b#Ɋ p[BwsT>d4ۧsnvnU_~,vƜJ1s QIz)(lv8MU=;56Gs#KMP=LvyGd}VwWBF'à ?MHUg2 !p7Qjڴ=ju JnA suMeƆҔ!)'8Ϣٔޝ(Vpצ֖d=ICJǠ{qkԭ߸i@Ku|p=..*+xz[Aqġ#s2aƊRR)*HRsi~a &fMP-KL@ZXy'x{}Zm+:)) IJ-iu ܒH'L(7yGӜq j 6ߌg1go,kرtY?W,pefOQS!K۟cҒA|սj>=⬒˧L[ ߿2JaB~Ru:Q] 0H~]7ƼI(}cq 'ήETq?fabӥvr )o-Q_'ᴎoK;Vo%~OK *bf:-ťIR`B5!RB@ï u ̯e\_U_ gES3QTaxU<~c?*#]MW,[8Oax]1bC|踤Plw5V%){t<d50iXSUm:Z┵i"1^B-PhJ&)O*DcWvM)}Pܗ-q\mmζZ-l@}aE6F@&Sg@ݚM ȹ 4#p\HdYDoH"\..RBHz_/5˘6KhJRPmƶim3,#ccoqa)*PtRmk7xDE\Y閣_X<~)c[[BP6YqS0%_;Àv~| VS؇ 'O0F0\U-d@7SJ*z3nyPOm~P3|Yʉr#CSN@ ƮRN)r"C:: #qbY. 6[2K2uǦHYRQMV G$Q+.>nNHq^ qmMVD+-#*U̒ p욳u:IBmPV@Or[b= 1UE_NmyKbNOU}the`|6֮P>\2PVIDiPO;9rmAHGWS]J*_G+kP2KaZH'KxWMZ%OYDRc+o?qGhmdSoh\D|:WUAQc yTq~^H/#pCZTI1ӏT4"ČZ}`w#*,ʹ 0i課Om*da^gJ݅{le9uF#Tֲ̲ٞC"qߍ ոޑo#XZTp@ o8(jdxw],f`~|,s^f1t|m򸄭/ctr5s79Q4H1꠲BB@l9@C+wpxu£Yc9?`@#omHs2)=2.ljg9$YS%*LRY7Z,*=䷘$armoϰUW.|rufIGwtZwo~5 YյhO+=8fF)W7L9lM̘·Y֘YLf큹pRF99.A "wz=E\Z'a 2Ǚ#;'}G*l^"q+2FQ hjkŦ${ޮ-T٭cf|3#~RJt$b(R(rdx >U b&9,>%E\ Άe$'q't*אެb-|dSBOO$R+H)܎K1m`;J2Y~9Og8=vqD`K[F)k[1m޼cn]skz$@)!I x՝"v9=ZA=`Ɠi :E)`7vI}dYI_ o:obo 3Q&D&2= Ά;>hy.*ⅥSӬ+q&j|UƧ}J0WW< ۋS)jQRjƯrN)Gű4Ѷ(S)Ǣ8iW52No˓ ۍ%5brOnL;n\G=^UdI8$&h'+(cȁ߫klS^cƗjԌEꭔgFȒ@}O*;evWVYJ\]X'5ղkFb 6Ro՜mi Ni>J?lPmU}>_Z&KKqrIDՉ~q3fL:Se>E-G{L6pe,8QIhaXaUA'ʂs+טIjP-y8ۈZ?J$WP Rs]|l(ԓsƊio(S0Y 8T97.WiLc~dxcE|2!XKƘਫ਼$((6~|d9u+qd^389Y6L.I?iIq9)O/뚅OXXVZF[یgQLK1RҖr@v#XlFНyS87kF!AsM^rkpjPDyS$Nqnxҍ!Uf!ehi2m`YI9r6 TFC}/y^Η5d'9A-J>{_l+`A['յϛ#w:݅%X}&PStQ"-\縵/$ƗhXb*yBS;Wջ_mcvt?2}1;qSdd~u:2k52R~z+|HE!)Ǟl7`0<,2*Hl-x^'_TVgZA'j ^2ΪN7t?w x1fIzC-ȖK^q;-WDvT78Z hK(P:Q- 8nZ܃e貾<1YT<,"6{/ ?͟|1:#gW>$dJdB=jf[%rE^il:BxSּ1հ,=*7 fcG#q eh?27,!7x6nLC4x},GeǝtC.vS F43zz\;QYC,6~;RYS/6|25vTimlv& nRh^ejRLGf? ۉҬܦƩ|Ȱ>3!viʯ>vオX3e_1zKȗ\qHS,EW[㺨uch⍸O}a>q6n6N6qN ! 1AQaq0@"2BRb#Pr3C`Scst$4D%Td ?Na3mCwxAmqmm$4n淿t'C"wzU=D\R+wp+YT&պ@ƃ3ޯ?AﶂaŘ@-Q=9Dռѻ@MVP܅G5fY6# ?0UQ,IX(6ڵ[DIMNލc&υj\XR|,4 jThAe^db#$]wOӪ1y%LYm뭛CUƃߜ}Cy1XνmF8jI]HۺиE@Ii;r8ӭVFՇ| &?3|xBMuSGe=Ӕ#BE5GY!z_eqр/W>|-Ci߇t1ޯќdR3ug=0 5[?#͏qcfH{ ?u=??ǯ}ZzhmΔBFTWPxs}G93 )gGR<>r h$'nchPBjJҧH -N1N?~}-q!=_2hcMlvY%UE@|vM2.Y[|y"EïKZF,ɯ?,q?vM 80jx";9vk+ ֧ ȺU?%vcVmA6Qg^MA}3nl QRNl8kkn'(M7m9وq%ޟ*h$Zk"$9: ?U8Sl,,|ɒxH(ѷGn/Q4PG%Ա8N! &7;eKM749R/%lc>x;>C:th?aKXbheᜋ^$Iհ hr7%F$EFdt5+(M6tÜUU|zW=aTsTgdqPQb'm1{|YXNb P~F^F:k6"j! Ir`1&-$Bevk:y#ywI0x=D4tUPZHڠ底taP6b>xaQ# WeFŮNjpJ* mQN*I-*ȩFg3 5Vʊɮa5FO@{NX?H]31Ri_uѕ 0 F~:60p͈SqX#a5>`o&+<2D: ڝ$nP*)N|yEjF5ټeihyZ >kbHavh-#!Po=@k̆IEN@}Ll?jO߭ʞQ|A07xwt!xfI2?Z<ץTcUj]陎Ltl }5ϓ$,Omˊ;@OjEj(ا,LXLOЦ90O .anA7j4 W_ٓzWjcBy՗+EM)dNg6y1_xp$Lv:9"zpʙ$^JԼ*ϭo=xLj6Ju82AH3$ٕ@=Vv]'qEz;I˼)=ɯx /W(Vp$ mu񶤑OqˎTr㠚xsrGCbypG1ߠw e8$⿄/M{*}W]˷.CK\ުx/$WPwr |i&}{X >$-l?-zglΆ(FhvS*b߲ڡn,|)mrH[a3ר[13o_U3TC$(=)0kgP u^=4 WYCҸ:vQרXàtkm,t*^,}D* "(I9R>``[~Q]#afi6l86:,ssN6j"A4IuQ6E,GnHzSHOuk5$I4ؤQ9@CwpBGv[]uOv0I4\yQѸ~>Z8Taqޣ;za/SI:ܫ_|>=Z8:SUIJ"IY8%b8H:QO6;7ISJҌAά3>cE+&jf$eC+z;V rʺmyeaQf&6ND.:NTvm<- uǝ\MvZYNNT-A>jr!SnO 13Ns%3D@`ܟ 1^c< aɽ̲Xë#w|ycW=9I*H8p^(4՗karOcWtO\ƍR8'KIQ?5>[}yUײ -h=% qThG2)"ו3]!kB*pFDlA,eEiHfPs5H:Փ~H0DتDIhF3c2E9H5zԑʚiX=:mxghd(v׊9iSOd@0ڽ:p5h-t&Xqӕ,ie|7A2O%PEhtjY1wЃ!  ࢽMy7\a@ţJ 4ȻF@o̒?4wx)]P~u57X 9^ܩU;Iꭆ 5 eK27({|Y׎ V\"Z1 Z}(Ǝ"1S_vE30>p; ΝD%xW?W?vo^Vidr[/&>~`9Why;R ;;ɮT?r$g1KACcKl:'3 cﳯ*"t8~l)m+U,z`(>yJ?h>]vЍG*{`;y]IT ;cNUfo¾h/$|NS1S"HVT4uhǜ]v;5͠x'C\SBplh}N ABx%ޭl/Twʽ]D=Kžr㻠l4SO?=k M: cCa#ha)ѐxcsgPiG{+xQI= zԫ+ 8"kñj=|c yCF/*9жh{ ?4o kmQNx;Y4膚aw?6>e]Qr:g,i"ԩA*M7qB?ӕFhV25r[7 Y }LR}*sg+xr2U=*'WSZDW]WǞ<叓{$9Ou4y90-1'*D`c^o?(9uݐ'PI& fJݮ:wSjfP1F:X H9dԯ˝[_54 }*;@ܨ ðynT?ןd#4rGͨH1|-#MrS3G3).᧏3vz֑r$G"`j 1tx0<ƆWh6y6,œGagAyb)hDß_mü gG;evݝnQ C-*oyaMI><]obD":GA-\%LT8c)+y76oQ#*{(F⽕y=rW\p۩cA^e6KʐcVf5$'->ՉN"F"UQ@fGb~#&M=8טJNu9D[̤so~ G9TtW^g5y$bY'سǴ=U-2 #MCt(i lj@Q 5̣i*OsxKf}\M{EV{υƇ);HIfeLȣr2>WIȂ6ik 5YOxȺ>Yf5'|H+98pjn.OyjY~iw'l;s2Y:'lgꥴ)o#'SaaKZ m}`169n"xI *+ }FP"l45'ZgE8?[X7(.Q-*ތL@̲v.5[=t\+CNܛ,gSQnH}*FG16&:t4ُ"Ạ$b |#rsaT ]ӽDP7ո0y)e$ٕvIh'QEAm*HRI=: 4牢) %_iNݧl] NtGHL ɱg<1V,J~ٹ"KQ 9HS9?@kr;we݁]I!{ @G["`J:n]{cAEVʆ#U96j#Ym\qe4hB7Cdv\MNgmAyQL4uLjj9#44tl^}LnR!t±]rh6ٍ>yҏNfU  Fm@8}/ujb9he:AyծwGpΧh5l}3p468)Udc;Us/֔YX1O2uqs`hwgr~{ RmhN؎*q 42*th>#E#HvOq}6e\,Wk#Xb>p}դ3T5†6[@Py*n|'f֧>lư΂̺SU'*qp_SM 'c6m ySʨ;MrƋmKxo,GmPAG:iw9}M(^V$ǒѽ9| aJSQarB;}ٻ֢2%Uc#gNaݕ'v[OY'3L3;,p]@S{lsX'cjwk'a.}}& dP*bK=ɍ!;3ngΊUߴmt'*{,=SzfD Ako~Gaoq_mi}#mPXhύmxǍ΂巿zfQc|kc?WY$_Lvl߶c`?ljݲˏ!V6UЂ(A4y)HpZ_x>eR$/`^'3qˏ-&Q=?CFVR DfV9{8gnh(P"6[D< E~0<@`G6Hгcc cK.5DdB`?XQ2ٿyqo&+1^ DW0ꊩG#QnL3c/x 11[yxპCWCcUĨ80me4.{muI=f0QRls9f9~fǨa"@8ȁQ#cicG$Gr/$W(WV"m7[mAmboD j۳ l^kh׽ # iXnveTka^Y4BNĕ0 !01@Q"2AaPq3BR?@4QT3,㺠W[=JKϞ2r^7vc:9 EߴwS#dIxu:Hp9E! V 2;73|F9Y*ʬFDu&y؟^EAA(ɩ^GV:ݜDy`Jr29ܾ㝉[E;FzxYGUeYC v-txIsםĘqEb+P\ :>iC';k|zرny]#ǿbQw(r|ӹs[D2v-%@;8<a[\o[ϧwI!*0krs)[J9^ʜp1) "/_>o<1AEy^C`x1'ܣnps`lfQ):lb>MejH^?kl3(z:1ŠK&?Q~{ٺhy/[V|6}KbXmn[-75q94dmc^h X5G-}دBޟ |rtMV+]c?-#ڛ^ǂ}LkrOu>-Dry D?:ޞUǜ7V?瓮"#rչģVR;n/_ ؉vݶe5db9/O009G5nWJpA*r9>1.[tsFnQ V 77R]ɫ8_0<՜IFu(v4Fk3E)N:yڮeP`1}$WSJSQNjٺ޵#lј(5=5lǏmoWv-1v,Wmn߀$x_DȬ0¤#QR[Vkzmw"9ZG7'[=Qj8R?zf\a=OU*oBA|G254 p.w7  &ξxGHp B%$gtЏ򤵍zHNuЯ-'40;_3 !01"@AQa2Pq#3BR?ʩcaen^8F<7;EA{EÖ1U/#d1an.1ě0ʾRh|RAo3m3 % 28Q yφHTo7lW>#i`qca m,B-j݋'mR1Ήt>Vps0IbIC.1Rea]H64B>o]($Bma!=?B KǾ+Ծ"nK*+[T#{EJSQs5:U\wĐf3܆&)IԆwE TlrTf6Q|Rh:[K zc֧GC%\_a84HcObiؖV7H )*ģK~Xhչ04?0 E<}3#u? |gS6ꊤ|I#Hڛ աwX97Ŀ%SLy6č|Fa 8b$sקhb9RAu7˨pČ_\*w묦F 4D~f|("mNKiS>$d7SlA/²SL|6N}S˯g]6; #. 403WebShell
403Webshell
Server IP : 179.61.189.58  /  Your IP : 216.73.216.85
Web Server : LiteSpeed
System : Linux sg-nme-web1277.main-hosting.eu 4.18.0-553.62.1.lve.el8.x86_64 #1 SMP Mon Jul 21 17:50:35 UTC 2025 x86_64
User : u728310944 ( 728310944)
PHP Version : 8.1.33
Disable Function : system, exec, shell_exec, passthru, mysql_list_dbs, ini_alter, dl, symlink, link, chgrp, leak, popen, apache_child_terminate, virtual, mb_send_mail
MySQL : OFF  |  cURL : ON  |  WGET : ON  |  Perl : OFF  |  Python : OFF  |  Sudo : OFF  |  Pkexec : OFF
Directory :  /opt/alt/alt-nodejs18/root/usr/include/node/

Upload File :
current_dir [ Writeable ] document_root [ Writeable ]

 

Command :


[ Back ]     

Current File : /opt/alt/alt-nodejs18/root/usr/include/node/v8-script.h
// Copyright 2021 the V8 project authors. All rights reserved.
// Use of this source code is governed by a BSD-style license that can be
// found in the LICENSE file.

#ifndef INCLUDE_V8_SCRIPT_H_
#define INCLUDE_V8_SCRIPT_H_

#include <stddef.h>
#include <stdint.h>

#include <memory>
#include <vector>

#include "v8-data.h"          // NOLINT(build/include_directory)
#include "v8-local-handle.h"  // NOLINT(build/include_directory)
#include "v8-maybe.h"         // NOLINT(build/include_directory)
#include "v8-message.h"       // NOLINT(build/include_directory)
#include "v8config.h"         // NOLINT(build/include_directory)

namespace v8 {

class Function;
class Object;
class PrimitiveArray;
class Script;

namespace internal {
class BackgroundDeserializeTask;
struct ScriptStreamingData;
}  // namespace internal

/**
 * A container type that holds relevant metadata for module loading.
 *
 * This is passed back to the embedder as part of
 * HostImportModuleDynamicallyCallback for module loading.
 */
class V8_EXPORT ScriptOrModule {
 public:
  /**
   * The name that was passed by the embedder as ResourceName to the
   * ScriptOrigin. This can be either a v8::String or v8::Undefined.
   */
  Local<Value> GetResourceName();

  /**
   * The options that were passed by the embedder as HostDefinedOptions to
   * the ScriptOrigin.
   */
  V8_DEPRECATED("Use HostDefinedOptions")
  Local<PrimitiveArray> GetHostDefinedOptions();
  Local<Data> HostDefinedOptions();
};

/**
 * A compiled JavaScript script, not yet tied to a Context.
 */
class V8_EXPORT UnboundScript {
 public:
  /**
   * Binds the script to the currently entered context.
   */
  Local<Script> BindToCurrentContext();

  int GetId() const;
  Local<Value> GetScriptName();

  /**
   * Data read from magic sourceURL comments.
   */
  Local<Value> GetSourceURL();
  /**
   * Data read from magic sourceMappingURL comments.
   */
  Local<Value> GetSourceMappingURL();

  /**
   * Returns zero based line number of the code_pos location in the script.
   * -1 will be returned if no information available.
   */
  int GetLineNumber(int code_pos);

  static const int kNoScriptId = 0;
};

/**
 * A compiled JavaScript module, not yet tied to a Context.
 */
class V8_EXPORT UnboundModuleScript : public Data {
  // Only used as a container for code caching.
};

/**
 * A location in JavaScript source.
 */
class V8_EXPORT Location {
 public:
  int GetLineNumber() { return line_number_; }
  int GetColumnNumber() { return column_number_; }

  Location(int line_number, int column_number)
      : line_number_(line_number), column_number_(column_number) {}

 private:
  int line_number_;
  int column_number_;
};

class V8_EXPORT ModuleRequest : public Data {
 public:
  /**
   * Returns the module specifier for this ModuleRequest.
   */
  Local<String> GetSpecifier() const;

  /**
   * Returns the source code offset of this module request.
   * Use Module::SourceOffsetToLocation to convert this to line/column numbers.
   */
  int GetSourceOffset() const;

  /**
   * Contains the import assertions for this request in the form:
   * [key1, value1, source_offset1, key2, value2, source_offset2, ...].
   * The keys and values are of type v8::String, and the source offsets are of
   * type Int32. Use Module::SourceOffsetToLocation to convert the source
   * offsets to Locations with line/column numbers.
   *
   * All assertions present in the module request will be supplied in this
   * list, regardless of whether they are supported by the host. Per
   * https://tc39.es/proposal-import-attributes/#sec-hostgetsupportedimportattributes,
   * hosts are expected to throw for assertions that they do not support (as
   * opposed to, for example, ignoring them).
   */
  Local<FixedArray> GetImportAssertions() const;

  V8_INLINE static ModuleRequest* Cast(Data* data);

 private:
  static void CheckCast(Data* obj);
};

/**
 * A compiled JavaScript module.
 */
class V8_EXPORT Module : public Data {
 public:
  /**
   * The different states a module can be in.
   *
   * This corresponds to the states used in ECMAScript except that "evaluated"
   * is split into kEvaluated and kErrored, indicating success and failure,
   * respectively.
   */
  enum Status {
    kUninstantiated,
    kInstantiating,
    kInstantiated,
    kEvaluating,
    kEvaluated,
    kErrored
  };

  /**
   * Returns the module's current status.
   */
  Status GetStatus() const;

  /**
   * For a module in kErrored status, this returns the corresponding exception.
   */
  Local<Value> GetException() const;

  /**
   * Returns the ModuleRequests for this module.
   */
  Local<FixedArray> GetModuleRequests() const;

  /**
   * For the given source text offset in this module, returns the corresponding
   * Location with line and column numbers.
   */
  Location SourceOffsetToLocation(int offset) const;

  /**
   * Returns the identity hash for this object.
   */
  int GetIdentityHash() const;

  using ResolveModuleCallback = MaybeLocal<Module> (*)(
      Local<Context> context, Local<String> specifier,
      Local<FixedArray> import_assertions, Local<Module> referrer);

  /**
   * Instantiates the module and its dependencies.
   *
   * Returns an empty Maybe<bool> if an exception occurred during
   * instantiation. (In the case where the callback throws an exception, that
   * exception is propagated.)
   */
  V8_WARN_UNUSED_RESULT Maybe<bool> InstantiateModule(
      Local<Context> context, ResolveModuleCallback callback);

  /**
   * Evaluates the module and its dependencies.
   *
   * If status is kInstantiated, run the module's code and return a Promise
   * object. On success, set status to kEvaluated and resolve the Promise with
   * the completion value; on failure, set status to kErrored and reject the
   * Promise with the error.
   *
   * If IsGraphAsync() is false, the returned Promise is settled.
   */
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Evaluate(Local<Context> context);

  /**
   * Returns the namespace object of this module.
   *
   * The module's status must be at least kInstantiated.
   */
  Local<Value> GetModuleNamespace();

  /**
   * Returns the corresponding context-unbound module script.
   *
   * The module must be unevaluated, i.e. its status must not be kEvaluating,
   * kEvaluated or kErrored.
   */
  Local<UnboundModuleScript> GetUnboundModuleScript();

  /**
   * Returns the underlying script's id.
   *
   * The module must be a SourceTextModule and must not have a kErrored status.
   */
  int ScriptId() const;

  /**
   * Returns whether this module or any of its requested modules is async,
   * i.e. contains top-level await.
   *
   * The module's status must be at least kInstantiated.
   */
  bool IsGraphAsync() const;

  /**
   * Returns whether the module is a SourceTextModule.
   */
  bool IsSourceTextModule() const;

  /**
   * Returns whether the module is a SyntheticModule.
   */
  bool IsSyntheticModule() const;

  /*
   * Callback defined in the embedder.  This is responsible for setting
   * the module's exported values with calls to SetSyntheticModuleExport().
   * The callback must return a resolved Promise to indicate success (where no
   * exception was thrown) and return an empy MaybeLocal to indicate falure
   * (where an exception was thrown).
   */
  using SyntheticModuleEvaluationSteps =
      MaybeLocal<Value> (*)(Local<Context> context, Local<Module> module);

  /**
   * Creates a new SyntheticModule with the specified export names, where
   * evaluation_steps will be executed upon module evaluation.
   * export_names must not contain duplicates.
   * module_name is used solely for logging/debugging and doesn't affect module
   * behavior.
   */
  static Local<Module> CreateSyntheticModule(
      Isolate* isolate, Local<String> module_name,
      const std::vector<Local<String>>& export_names,
      SyntheticModuleEvaluationSteps evaluation_steps);

  /**
   * Set this module's exported value for the name export_name to the specified
   * export_value. This method must be called only on Modules created via
   * CreateSyntheticModule.  An error will be thrown if export_name is not one
   * of the export_names that were passed in that CreateSyntheticModule call.
   * Returns Just(true) on success, Nothing<bool>() if an error was thrown.
   */
  V8_WARN_UNUSED_RESULT Maybe<bool> SetSyntheticModuleExport(
      Isolate* isolate, Local<String> export_name, Local<Value> export_value);

  V8_INLINE static Module* Cast(Data* data);

 private:
  static void CheckCast(Data* obj);
};

/**
 * A compiled JavaScript script, tied to a Context which was active when the
 * script was compiled.
 */
class V8_EXPORT Script {
 public:
  /**
   * A shorthand for ScriptCompiler::Compile().
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, Local<String> source,
      ScriptOrigin* origin = nullptr);

  /**
   * Runs the script returning the resulting value. It will be run in the
   * context in which it was created (ScriptCompiler::CompileBound or
   * UnboundScript::BindToCurrentContext()).
   */
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context);
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context,
                                              Local<Data> host_defined_options);

  /**
   * Returns the corresponding context-unbound script.
   */
  Local<UnboundScript> GetUnboundScript();

  /**
   * The name that was passed by the embedder as ResourceName to the
   * ScriptOrigin. This can be either a v8::String or v8::Undefined.
   */
  Local<Value> GetResourceName();
};

enum class ScriptType { kClassic, kModule };

/**
 * For compiling scripts.
 */
class V8_EXPORT ScriptCompiler {
 public:
  class ConsumeCodeCacheTask;

  /**
   * Compilation data that the embedder can cache and pass back to speed up
   * future compilations. The data is produced if the CompilerOptions passed to
   * the compilation functions in ScriptCompiler contains produce_data_to_cache
   * = true. The data to cache can then can be retrieved from
   * UnboundScript.
   */
  struct V8_EXPORT CachedData {
    enum BufferPolicy { BufferNotOwned, BufferOwned };

    CachedData()
        : data(nullptr),
          length(0),
          rejected(false),
          buffer_policy(BufferNotOwned) {}

    // If buffer_policy is BufferNotOwned, the caller keeps the ownership of
    // data and guarantees that it stays alive until the CachedData object is
    // destroyed. If the policy is BufferOwned, the given data will be deleted
    // (with delete[]) when the CachedData object is destroyed.
    CachedData(const uint8_t* data, int length,
               BufferPolicy buffer_policy = BufferNotOwned);
    ~CachedData();
    // TODO(marja): Async compilation; add constructors which take a callback
    // which will be called when V8 no longer needs the data.
    const uint8_t* data;
    int length;
    bool rejected;
    BufferPolicy buffer_policy;

    // Prevent copying.
    CachedData(const CachedData&) = delete;
    CachedData& operator=(const CachedData&) = delete;
  };

  /**
   * Source code which can be then compiled to a UnboundScript or Script.
   */
  class Source {
   public:
    // Source takes ownership of both CachedData and CodeCacheConsumeTask.
    // The caller *must* ensure that the cached data is from a trusted source.
    V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
                     CachedData* cached_data = nullptr,
                     ConsumeCodeCacheTask* consume_cache_task = nullptr);
    // Source takes ownership of both CachedData and CodeCacheConsumeTask.
    V8_INLINE explicit Source(
        Local<String> source_string, CachedData* cached_data = nullptr,
        ConsumeCodeCacheTask* consume_cache_task = nullptr);
    V8_INLINE ~Source() = default;

    // Ownership of the CachedData or its buffers is *not* transferred to the
    // caller. The CachedData object is alive as long as the Source object is
    // alive.
    V8_INLINE const CachedData* GetCachedData() const;

    V8_INLINE const ScriptOriginOptions& GetResourceOptions() const;

   private:
    friend class ScriptCompiler;

    Local<String> source_string;

    // Origin information
    Local<Value> resource_name;
    int resource_line_offset;
    int resource_column_offset;
    ScriptOriginOptions resource_options;
    Local<Value> source_map_url;
    Local<Data> host_defined_options;

    // Cached data from previous compilation (if a kConsume*Cache flag is
    // set), or hold newly generated cache data (kProduce*Cache flags) are
    // set when calling a compile method.
    std::unique_ptr<CachedData> cached_data;
    std::unique_ptr<ConsumeCodeCacheTask> consume_cache_task;
  };

  /**
   * For streaming incomplete script data to V8. The embedder should implement a
   * subclass of this class.
   */
  class V8_EXPORT ExternalSourceStream {
   public:
    virtual ~ExternalSourceStream() = default;

    /**
     * V8 calls this to request the next chunk of data from the embedder. This
     * function will be called on a background thread, so it's OK to block and
     * wait for the data, if the embedder doesn't have data yet. Returns the
     * length of the data returned. When the data ends, GetMoreData should
     * return 0. Caller takes ownership of the data.
     *
     * When streaming UTF-8 data, V8 handles multi-byte characters split between
     * two data chunks, but doesn't handle multi-byte characters split between
     * more than two data chunks. The embedder can avoid this problem by always
     * returning at least 2 bytes of data.
     *
     * When streaming UTF-16 data, V8 does not handle characters split between
     * two data chunks. The embedder has to make sure that chunks have an even
     * length.
     *
     * If the embedder wants to cancel the streaming, they should make the next
     * GetMoreData call return 0. V8 will interpret it as end of data (and most
     * probably, parsing will fail). The streaming task will return as soon as
     * V8 has parsed the data it received so far.
     */
    virtual size_t GetMoreData(const uint8_t** src) = 0;
  };

  /**
   * Source code which can be streamed into V8 in pieces. It will be parsed
   * while streaming and compiled after parsing has completed. StreamedSource
   * must be kept alive while the streaming task is run (see ScriptStreamingTask
   * below).
   */
  class V8_EXPORT StreamedSource {
   public:
    enum Encoding { ONE_BYTE, TWO_BYTE, UTF8, WINDOWS_1252 };

    StreamedSource(std::unique_ptr<ExternalSourceStream> source_stream,
                   Encoding encoding);
    ~StreamedSource();

    internal::ScriptStreamingData* impl() const { return impl_.get(); }

    // Prevent copying.
    StreamedSource(const StreamedSource&) = delete;
    StreamedSource& operator=(const StreamedSource&) = delete;

   private:
    std::unique_ptr<internal::ScriptStreamingData> impl_;
  };

  /**
   * A streaming task which the embedder must run on a background thread to
   * stream scripts into V8. Returned by ScriptCompiler::StartStreaming.
   */
  class V8_EXPORT ScriptStreamingTask final {
   public:
    void Run();

   private:
    friend class ScriptCompiler;

    explicit ScriptStreamingTask(internal::ScriptStreamingData* data)
        : data_(data) {}

    internal::ScriptStreamingData* data_;
  };

  /**
   * A task which the embedder must run on a background thread to
   * consume a V8 code cache. Returned by
   * ScriptCompiler::StarConsumingCodeCache.
   */
  class V8_EXPORT ConsumeCodeCacheTask final {
   public:
    ~ConsumeCodeCacheTask();

    void Run();

   private:
    friend class ScriptCompiler;

    explicit ConsumeCodeCacheTask(
        std::unique_ptr<internal::BackgroundDeserializeTask> impl);

    std::unique_ptr<internal::BackgroundDeserializeTask> impl_;
  };

  enum CompileOptions {
    kNoCompileOptions = 0,
    kConsumeCodeCache,
    kEagerCompile
  };

  /**
   * The reason for which we are not requesting or providing a code cache.
   */
  enum NoCacheReason {
    kNoCacheNoReason = 0,
    kNoCacheBecauseCachingDisabled,
    kNoCacheBecauseNoResource,
    kNoCacheBecauseInlineScript,
    kNoCacheBecauseModule,
    kNoCacheBecauseStreamingSource,
    kNoCacheBecauseInspector,
    kNoCacheBecauseScriptTooSmall,
    kNoCacheBecauseCacheTooCold,
    kNoCacheBecauseV8Extension,
    kNoCacheBecauseExtensionModule,
    kNoCacheBecausePacScript,
    kNoCacheBecauseInDocumentWrite,
    kNoCacheBecauseResourceWithNoCacheHandler,
    kNoCacheBecauseDeferredProduceCodeCache
  };

  /**
   * Compiles the specified script (context-independent).
   * Cached data as part of the source object can be optionally produced to be
   * consumed later to speed up compilation of identical source scripts.
   *
   * Note that when producing cached data, the source must point to NULL for
   * cached data. When consuming cached data, the cached data must have been
   * produced by the same version of V8, and the embedder needs to ensure the
   * cached data is the correct one for the given script.
   *
   * \param source Script source code.
   * \return Compiled script object (context independent; for running it must be
   *   bound to a context).
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript(
      Isolate* isolate, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Compiles the specified script (bound to current context).
   *
   * \param source Script source code.
   * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile()
   *   using pre_data speeds compilation if it's done multiple times.
   *   Owned by caller, no references are kept when this function returns.
   * \return Compiled script object, bound to the context that was active
   *   when this function was called. When run it will always use this
   *   context.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Returns a task which streams script data into V8, or NULL if the script
   * cannot be streamed. The user is responsible for running the task on a
   * background thread and deleting it. When ran, the task starts parsing the
   * script, and it will request data from the StreamedSource as needed. When
   * ScriptStreamingTask::Run exits, all data has been streamed and the script
   * can be compiled (see Compile below).
   *
   * This API allows to start the streaming with as little data as possible, and
   * the remaining data (for example, the ScriptOrigin) is passed to Compile.
   */
  static ScriptStreamingTask* StartStreaming(
      Isolate* isolate, StreamedSource* source,
      ScriptType type = ScriptType::kClassic);

  static ConsumeCodeCacheTask* StartConsumingCodeCache(
      Isolate* isolate, std::unique_ptr<CachedData> source);

  /**
   * Compiles a streamed script (bound to current context).
   *
   * This can only be called after the streaming has finished
   * (ScriptStreamingTask has been run). V8 doesn't construct the source string
   * during streaming, so the embedder needs to pass the full source here.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, StreamedSource* source,
      Local<String> full_source_string, const ScriptOrigin& origin);

  /**
   * Return a version tag for CachedData for the current V8 version & flags.
   *
   * This value is meant only for determining whether a previously generated
   * CachedData instance is still valid; the tag has no other meaing.
   *
   * Background: The data carried by CachedData may depend on the exact
   *   V8 version number or current compiler flags. This means that when
   *   persisting CachedData, the embedder must take care to not pass in
   *   data from another V8 version, or the same version with different
   *   features enabled.
   *
   *   The easiest way to do so is to clear the embedder's cache on any
   *   such change.
   *
   *   Alternatively, this tag can be stored alongside the cached data and
   *   compared when it is being used.
   */
  static uint32_t CachedDataVersionTag();

  /**
   * Compile an ES module, returning a Module that encapsulates
   * the compiled code.
   *
   * Corresponds to the ParseModule abstract operation in the
   * ECMAScript specification.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule(
      Isolate* isolate, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Compiles a streamed module script.
   *
   * This can only be called after the streaming has finished
   * (ScriptStreamingTask has been run). V8 doesn't construct the source string
   * during streaming, so the embedder needs to pass the full source here.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule(
      Local<Context> context, StreamedSource* v8_source,
      Local<String> full_source_string, const ScriptOrigin& origin);

  /**
   * Compile a function for a given context. This is equivalent to running
   *
   * with (obj) {
   *   return function(args) { ... }
   * }
   *
   * It is possible to specify multiple context extensions (obj in the above
   * example).
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext(
      Local<Context> context, Source* source, size_t arguments_count,
      Local<String> arguments[], size_t context_extension_count,
      Local<Object> context_extensions[],
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason,
      Local<ScriptOrModule>* script_or_module_out = nullptr);
  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunction(
      Local<Context> context, Source* source, size_t arguments_count = 0,
      Local<String> arguments[] = nullptr, size_t context_extension_count = 0,
      Local<Object> context_extensions[] = nullptr,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Creates and returns code cache for the specified unbound_script.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCache(Local<UnboundScript> unbound_script);

  /**
   * Creates and returns code cache for the specified unbound_module_script.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCache(
      Local<UnboundModuleScript> unbound_module_script);

  /**
   * Creates and returns code cache for the specified function that was
   * previously produced by CompileFunction.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCacheForFunction(Local<Function> function);

 private:
  static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal(
      Isolate* isolate, Source* source, CompileOptions options,
      NoCacheReason no_cache_reason);

  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInternal(
      Local<Context> context, Source* source, size_t arguments_count,
      Local<String> arguments[], size_t context_extension_count,
      Local<Object> context_extensions[], CompileOptions options,
      NoCacheReason no_cache_reason,
      Local<ScriptOrModule>* script_or_module_out);
};

ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
                               CachedData* data,
                               ConsumeCodeCacheTask* consume_cache_task)
    : source_string(string),
      resource_name(origin.ResourceName()),
      resource_line_offset(origin.LineOffset()),
      resource_column_offset(origin.ColumnOffset()),
      resource_options(origin.Options()),
      source_map_url(origin.SourceMapUrl()),
      host_defined_options(origin.GetHostDefinedOptions()),
      cached_data(data),
      consume_cache_task(consume_cache_task) {}

ScriptCompiler::Source::Source(Local<String> string, CachedData* data,
                               ConsumeCodeCacheTask* consume_cache_task)
    : source_string(string),
      cached_data(data),
      consume_cache_task(consume_cache_task) {}

const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData()
    const {
  return cached_data.get();
}

const ScriptOriginOptions& ScriptCompiler::Source::GetResourceOptions() const {
  return resource_options;
}

ModuleRequest* ModuleRequest::Cast(Data* data) {
#ifdef V8_ENABLE_CHECKS
  CheckCast(data);
#endif
  return reinterpret_cast<ModuleRequest*>(data);
}

Module* Module::Cast(Data* data) {
#ifdef V8_ENABLE_CHECKS
  CheckCast(data);
#endif
  return reinterpret_cast<Module*>(data);
}

}  // namespace v8

#endif  // INCLUDE_V8_SCRIPT_H_

Youez - 2016 - github.com/yon3zu
LinuXploit